About CID 164803445
CID 164803445 (PubChem CID 164803445) has the molecular formula C46H29IrN3-2
and a molecular weight of 815.98 g/mol.
Molecular Properties
| Compound Name | CID 164803445 |
| PubChem CID | 164803445 |
| Molecular Formula | C46H29IrN3-2 |
| Molecular Weight | 815.98 g/mol |
| Exact Mass | 816.20 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cc2c(cc1-c1ccc(-c3ccccc3)cn1)c1cc(-c3ccccc3)cc3c4ccccc4n2c13.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C35H21N2.C11H8N.Ir/c1-3-9-23(10-4-1)26-15-17-32(36-22-26)25-16-18-34-29(19-25)31-21-27(24-11-5-2-6-12-24)20-30-28-13-7-8-14-33(28)37(34)35(30)31;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-15,17-22H;1-6,8-9H;/q2*-1; |
| InChIKey | QSKCFQDHDGMZIB-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 815.98 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 164803445 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164803445?
The IUPAC name of CID 164803445 (CID 164803445) is not available.
What is the SMILES notation for CID 164803445?
The canonical SMILES for CID 164803445 is [Ir].[c-]1cc2c(cc1-c1ccc(-c3ccccc3)cn1)c1cc(-c3ccccc3)cc3c4ccccc4n2c13.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of CID 164803445?
The InChIKey is QSKCFQDHDGMZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H21N2.C11H8N.Ir/c1-3-9-23(10-4-1)26-15-17-32(36-22-26)25-16-18-34-29(19-25)31-21-27(24-11-5-2-6-12-24)20-30-28-13-7-8-14-33(28)37(34)35(30)31;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-15,17-22H;1-6,8-9H;/q2*-1;.
What are the key properties of CID 164803445?
CID 164803445 has a molecular weight of 815.98 g/mol, XLogP of 11.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164803445 is sourced from PubChem (CID 164803445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).