C28H18F2IrN2-2 — CID 168823172
2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;5-phenyl-2-phenylpyridine (PubChem CID 168823172) has the molecular formula C28H18F2IrN2-2 and a molecular weight of 612.68 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;5-phenyl-2-phenylpyridine.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;5-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168823172 |
| Molecular Formula | C28H18F2IrN2-2 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 613.11 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;5-phenyl-2-phenylpyridine |
| SMILES | Fc1c[c-]c(-c2ccccn2)c(F)c1.[Ir].[c-]1ccccc1-c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H12N.C11H6F2N.Ir/c1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15;12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h1-9,11-13H;1-4,6-7H;/q2*-1; |
| InChIKey | GDQCFNPWUUBMBI-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|