C28H17F3IrN2-2 — CID 168821993
iridium;2-phenylpyridine;4-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine (PubChem CID 168821993) has the molecular formula C28H17F3IrN2-2 and a molecular weight of 630.67 g/mol. Its IUPAC name is iridium;2-phenylpyridine;4-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine.
| Compound Name | iridium;2-phenylpyridine;4-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 168821993 |
| Molecular Formula | C28H17F3IrN2-2 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 631.10 |
| IUPAC Name | iridium;2-phenylpyridine;4-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine |
| SMILES | Fc1[c-]c(-c2cc(-c3ccccc3)ccn2)c(F)cc1F.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H9F3N.C11H8N.Ir/c18-14-10-16(20)15(19)9-13(14)17-8-12(6-7-21-17)11-4-2-1-3-5-11;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8,10H;1-6,8-9H;/q2*-1; |
| InChIKey | OEGKOUAVUOALFQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|