C29H19F3IrN2-2 — CID 168821808
iridium;5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine;2-phenylpyridine (PubChem CID 168821808) has the molecular formula C29H19F3IrN2-2 and a molecular weight of 644.70 g/mol. Its IUPAC name is iridium;5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine;2-phenylpyridine.
| Compound Name | iridium;5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine;2-phenylpyridine |
|---|---|
| PubChem CID | 168821808 |
| Molecular Formula | C29H19F3IrN2-2 |
| Molecular Weight | 644.70 g/mol |
| Exact Mass | 645.11 |
| IUPAC Name | iridium;5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine;2-phenylpyridine |
| SMILES | Cc1cnc(-c2[c-]c(F)cc(F)c2F)cc1-c1ccccc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C18H11F3N.C11H8N.Ir/c1-11-10-22-17(9-14(11)12-5-3-2-4-6-12)15-7-13(19)8-16(20)18(15)21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-6,8-10H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | AHPFDHIANZBUJD-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.70 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|