C29H21F3IrN3 — CID 168821564
5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine (PubChem CID 168821564) has the molecular formula C29H21F3IrN3 and a molecular weight of 660.72 g/mol. Its IUPAC name is 5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine.
| Compound Name | 5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 168821564 |
| Molecular Formula | C29H21F3IrN3 |
| Molecular Weight | 660.72 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | 5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);5-methyl-4-phenyl-2-(2,3,5-trifluorobenzene-6-id-1-yl)pyridine |
| SMILES | Cc1cnc(-c2[c-]c(F)cc(F)c2F)cc1-c1ccccc1.[Ir+3].[c-]1cccc2c1C1[N-]C=CN1CC2 |
| InChI | InChI=1S/C18H11F3N.C11H10N2.Ir/c1-11-10-22-17(9-14(11)12-5-3-2-4-6-12)15-7-13(19)8-16(20)18(15)21;1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;/h2-6,8-10H,1H3;1-3,6,8,11H,5,7H2;/q-1;-2;+3 |
| InChIKey | RWBQNQMMYOSTLA-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 30.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|