C13H12F2NPt-3 — CID 21044191
carbanide;2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum (PubChem CID 21044191) has the molecular formula C13H12F2NPt-3 and a molecular weight of 415.32 g/mol. Its IUPAC name is carbanide;2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum.
| Compound Name | carbanide;2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum |
|---|---|
| PubChem CID | 21044191 |
| Molecular Formula | C13H12F2NPt-3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | carbanide;2-(2,4-difluorobenzene-6-id-1-yl)pyridine;platinum |
| SMILES | Fc1c[c-]c(-c2ccccn2)c(F)c1.[CH3-].[CH3-].[Pt] |
| InChI | InChI=1S/C11H6F2N.2CH3.Pt/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;;;/h1-4,6-7H;2*1H3;/q3*-1; |
| InChIKey | SLCREFLCPOFONT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|