C28H21ClF2N2PPt+ — CID 164576028
chloroplatinum(1+);2-(2,4-difluorobenzene-6-id-1-yl)pyridine;diphenyl(pyridin-2-yl)phosphanium (PubChem CID 164576028) has the molecular formula C28H21ClF2N2PPt+ and a molecular weight of 684.99 g/mol. Its IUPAC name is chloroplatinum(1+);2-(2,4-difluorobenzene-6-id-1-yl)pyridine;diphenyl(pyridin-2-yl)phosphanium.
| Compound Name | chloroplatinum(1+);2-(2,4-difluorobenzene-6-id-1-yl)pyridine;diphenyl(pyridin-2-yl)phosphanium |
|---|---|
| PubChem CID | 164576028 |
| Molecular Formula | C28H21ClF2N2PPt+ |
| Molecular Weight | 684.99 g/mol |
| Exact Mass | 684.07 |
| IUPAC Name | chloroplatinum(1+);2-(2,4-difluorobenzene-6-id-1-yl)pyridine;diphenyl(pyridin-2-yl)phosphanium |
| SMILES | Cl[Pt+].Fc1c[c-]c(-c2ccccn2)c(F)c1.c1ccc([PH+](c2ccccc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C17H14NP.C11H6F2N.ClH.Pt/c1-3-9-15(10-4-1)19(16-11-5-2-6-12-16)17-13-7-8-14-18-17;12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;;/h1-14H;1-4,6-7H;1H;/q;-1;;+2 |
| InChIKey | VXOOJOWCBWVYBP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|