C41H25IrN3S-2 — CID 164803221
CID 164803221 (PubChem CID 164803221) has the molecular formula C41H25IrN3S-2 and a molecular weight of 783.96 g/mol.
| Compound Name | CID 164803221 |
|---|---|
| PubChem CID | 164803221 |
| Molecular Formula | C41H25IrN3S-2 |
| Molecular Weight | 783.96 g/mol |
| Exact Mass | 784.14 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2[c-]cc3c(c2)c2cc4sc5ccccc5c4c4c5ccccc5n3c24)nc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C30H17N2S.C11H8N.Ir/c1-17-10-12-23(31-16-17)18-11-13-25-21(14-18)22-15-27-28(20-7-3-5-9-26(20)33-27)29-19-6-2-4-8-24(19)32(25)30(22)29;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-10,12-16H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | YBFYHNBKPQZIOY-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.96 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|