C47H35IrN3O-2 — CID 168771829
CID 168771829 (PubChem CID 168771829) has the molecular formula C47H35IrN3O-2 and a molecular weight of 853.05 g/mol.
| Compound Name | CID 168771829 |
|---|---|
| PubChem CID | 168771829 |
| Molecular Formula | C47H35IrN3O-2 |
| Molecular Weight | 853.05 g/mol |
| Exact Mass | 853.26 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]cc3c(c2)c2cc4c5ccccc5oc4c4c5ccccc5n3c24)cc1CC1CCCC1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C36H27N2O.C11H8N.Ir/c1-21-20-37-30(18-24(21)16-22-8-2-3-9-22)23-14-15-32-27(17-23)28-19-29-25-10-5-7-13-33(25)39-36(29)34-26-11-4-6-12-31(26)38(32)35(28)34;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-7,10-13,15,17-20,22H,2-3,8-9,16H2,1H3;1-6,8-9H;/q2*-1;/i1D3;; |
| InChIKey | KUIVSQSVIDVRST-GXXYEPOPSA-N |
| XLogP | 12.19 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.05 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|