C44H40IrN2O-2 — CID 162708012
4-(cyclohexylmethyl)-5-methyl-2-phenylpyridine;iridium;2-[9-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine (PubChem CID 162708012) has the molecular formula C44H40IrN2O-2 and a molecular weight of 805.03 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-5-methyl-2-phenylpyridine;iridium;2-[9-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine.
| Compound Name | 4-(cyclohexylmethyl)-5-methyl-2-phenylpyridine;iridium;2-[9-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine |
|---|---|
| PubChem CID | 162708012 |
| Molecular Formula | C44H40IrN2O-2 |
| Molecular Weight | 805.03 g/mol |
| Exact Mass | 805.28 |
| IUPAC Name | 4-(cyclohexylmethyl)-5-methyl-2-phenylpyridine;iridium;2-[9-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine |
| SMILES | CC(c1ccccc1)c1cccc2oc3c(-c4ccccn4)[c-]ccc3c12.Cc1cnc(-c2[c-]cccc2)cc1CC1CCCCC1.[Ir] |
| InChI | InChI=1S/C25H18NO.C19H22N.Ir/c1-17(18-9-3-2-4-10-18)19-11-8-15-23-24(19)21-13-7-12-20(25(21)27-23)22-14-5-6-16-26-22;1-15-14-20-19(17-10-6-3-7-11-17)13-18(15)12-16-8-4-2-5-9-16;/h2-11,13-17H,1H3;3,6-7,10,13-14,16H,2,4-5,8-9,12H2,1H3;/q2*-1; |
| InChIKey | IRVJDYQCLCJBEL-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.03 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|