C39H34IrN2OSi-2 — CID 162707539
iridium;2-[7-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 162707539) has the molecular formula C39H34IrN2OSi-2 and a molecular weight of 767.02 g/mol. Its IUPAC name is iridium;2-[7-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;2-[7-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 162707539 |
| Molecular Formula | C39H34IrN2OSi-2 |
| Molecular Weight | 767.02 g/mol |
| Exact Mass | 767.21 |
| IUPAC Name | iridium;2-[7-(1-phenylethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | CC(c1ccccc1)c1ccc2c(c1)oc1c(-c3ccccn3)[c-]ccc12.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C25H18NO.C14H16NSi.Ir/c1-17(18-8-3-2-4-9-18)19-13-14-20-21-10-7-11-22(23-12-5-6-15-26-23)25(21)27-24(20)16-19;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h2-10,12-17H,1H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | SFNZBPVOJRNXDE-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.02 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|