C33H32IrN2Si-2 — CID 162709837
iridium;2-phenyl-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 162709837) has the molecular formula C33H32IrN2Si-2 and a molecular weight of 676.94 g/mol. Its IUPAC name is iridium;2-phenyl-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;2-phenyl-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 162709837 |
| Molecular Formula | C33H32IrN2Si-2 |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 677.20 |
| IUPAC Name | iridium;2-phenyl-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | CC(c1ccccc1)c1ccnc(-c2[c-]cccc2)c1.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C19H16N.C14H16NSi.Ir/c1-15(16-8-4-2-5-9-16)18-12-13-20-19(14-18)17-10-6-3-7-11-17;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h2-10,12-15H,1H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | SMPUQNJCUGHCIM-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|