C38H42IrN2Si-2 — CID 162707114
iridium;2-(4-methylbenzene-6-id-1-yl)-4-(1-phenylethyl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 162707114) has the molecular formula C38H42IrN2Si-2 and a molecular weight of 747.07 g/mol. Its IUPAC name is iridium;2-(4-methylbenzene-6-id-1-yl)-4-(1-phenylethyl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | iridium;2-(4-methylbenzene-6-id-1-yl)-4-(1-phenylethyl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 162707114 |
| Molecular Formula | C38H42IrN2Si-2 |
| Molecular Weight | 747.07 g/mol |
| Exact Mass | 747.28 |
| IUPAC Name | iridium;2-(4-methylbenzene-6-id-1-yl)-4-(1-phenylethyl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1c[c-]c(-c2cc(C(C)c3ccccc3)ccn2)cc1.[Ir] |
| InChI | InChI=1S/C20H18N.C18H24NSi.Ir/c1-15-8-10-18(11-9-15)20-14-19(12-13-21-20)16(2)17-6-4-3-5-7-17;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h3-10,12-14,16H,1-2H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | WTPGGJGYKPKWAG-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.07 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|