C46H45IrN3-2 — CID 165161292
CID 165161292 (PubChem CID 165161292) has the molecular formula C46H45IrN3-2 and a molecular weight of 842.17 g/mol.
| Compound Name | CID 165161292 |
|---|---|
| PubChem CID | 165161292 |
| Molecular Formula | C46H45IrN3-2 |
| Molecular Weight | 842.17 g/mol |
| Exact Mass | 842.39 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]cc3c4cccc5c6ccccc6n(c3c2)c54)cc1C([2H])([2H])C(C)(C)C.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C29H25N2.C17H20N.Ir/c1-18-17-30-25(14-20(18)16-29(2,3)4)19-12-13-22-24-10-7-9-23-21-8-5-6-11-26(21)31(28(23)24)27(22)15-19;1-13-12-18-16(14-8-6-5-7-9-14)10-15(13)11-17(2,3)4;/h5-11,13-15,17H,16H2,1-4H3;5-8,10,12H,11H2,1-4H3;/q2*-1;/i1D3,16D2;1D3,11D2; |
| InChIKey | UWYOCJWCFUGYJG-UBGOXLGUSA-N |
| XLogP | 12.04 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.17 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|