C44H41IrN3-2 — CID 165160967
CID 165160967 (PubChem CID 165160967) has the molecular formula C44H41IrN3-2 and a molecular weight of 808.07 g/mol.
| Compound Name | CID 165160967 |
|---|---|
| PubChem CID | 165160967 |
| Molecular Formula | C44H41IrN3-2 |
| Molecular Weight | 808.07 g/mol |
| Exact Mass | 808.32 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccc(-c2[c-]ccc3c4cccc5c6ccccc6n(c23)c54)nc1)C(C)(C)C.[2H]C([2H])(c1ccnc(-c2[c-]cccc2)c1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C28H23N2.C16H18N.Ir/c1-28(2,3)16-18-14-15-24(29-17-18)23-12-7-11-22-21-10-6-9-20-19-8-4-5-13-25(19)30(26(20)21)27(22)23;1-16(2,3)12-13-9-10-17-15(11-13)14-7-5-4-6-8-14;/h4-11,13-15,17H,16H2,1-3H3;4-7,9-11H,12H2,1-3H3;/q2*-1;/i16D2;12D2; |
| InChIKey | YRQLXYQDNNRPEV-GKAWAJHLSA-N |
| XLogP | 11.42 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.07 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|