C52H35IrN3-2 — CID 153423282
iridium;2-phenylpyridine;9-phenyl-3-[3-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]carbazole (PubChem CID 153423282) has the molecular formula C52H35IrN3-2 and a molecular weight of 894.09 g/mol. Its IUPAC name is iridium;2-phenylpyridine;9-phenyl-3-[3-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]carbazole.
| Compound Name | iridium;2-phenylpyridine;9-phenyl-3-[3-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 153423282 |
| Molecular Formula | C52H35IrN3-2 |
| Molecular Weight | 894.09 g/mol |
| Exact Mass | 894.25 |
| IUPAC Name | iridium;2-phenylpyridine;9-phenyl-3-[3-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]carbazole |
| SMILES | [Ir].[c-]1ccc(-c2cccc(-c3cccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)c3)c2)cc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C41H27N2.C11H8N.Ir/c1-2-17-36(18-3-1)43-40-21-5-4-19-37(40)38-28-34(22-23-41(38)43)32-14-9-12-30(26-32)29-11-8-13-31(25-29)33-15-10-16-35(27-33)39-20-6-7-24-42-39;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-15,17-28H;1-6,8-9H;/q2*-1; |
| InChIKey | HLUSSJWVGQIWFI-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.09 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|