C44H32IrN2S-2 — CID 176775747
8-tert-butyl-1-(2H-dibenzothiophen-2-id-3-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine (PubChem CID 176775747) has the molecular formula C44H32IrN2S-2 and a molecular weight of 813.04 g/mol. Its IUPAC name is 8-tert-butyl-1-(2H-dibenzothiophen-2-id-3-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine.
| Compound Name | 8-tert-butyl-1-(2H-dibenzothiophen-2-id-3-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 176775747 |
| Molecular Formula | C44H32IrN2S-2 |
| Molecular Weight | 813.04 g/mol |
| Exact Mass | 813.19 |
| IUPAC Name | 8-tert-butyl-1-(2H-dibenzothiophen-2-id-3-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
| SMILES | CC(C)(C)c1ccc2c(ccc3c4ccnc(-c5[c-]cc6c(c5)sc5ccccc56)c4ccc23)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C33H24NS.C11H8N.Ir/c1-33(2,3)22-10-13-23-20(18-22)8-11-25-24(23)14-15-29-26(25)16-17-34-32(29)21-9-12-28-27-6-4-5-7-30(27)35-31(28)19-21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-8,10-19H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | BMGDTUDMRDXRFA-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.04 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|