C51H41IrN5O-2 — CID 176775895
1-(2H-dibenzofuran-2-id-3-yl)-7-(4,6-ditert-butyl-1,3,5-triazin-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine (PubChem CID 176775895) has the molecular formula C51H41IrN5O-2 and a molecular weight of 932.14 g/mol. Its IUPAC name is 1-(2H-dibenzofuran-2-id-3-yl)-7-(4,6-ditert-butyl-1,3,5-triazin-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine.
| Compound Name | 1-(2H-dibenzofuran-2-id-3-yl)-7-(4,6-ditert-butyl-1,3,5-triazin-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 176775895 |
| Molecular Formula | C51H41IrN5O-2 |
| Molecular Weight | 932.14 g/mol |
| Exact Mass | 932.30 |
| IUPAC Name | 1-(2H-dibenzofuran-2-id-3-yl)-7-(4,6-ditert-butyl-1,3,5-triazin-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
| SMILES | CC(C)(C)c1nc(-c2cccc3c2ccc2c4ccnc(-c5[c-]cc6c(c5)oc5ccccc56)c4ccc32)nc(C(C)(C)C)n1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C40H33N4O.C11H8N.Ir/c1-39(2,3)37-42-36(43-38(44-37)40(4,5)6)32-12-9-11-24-25-18-19-31-28(26(25)16-17-27(24)32)20-21-41-35(31)23-14-15-30-29-10-7-8-13-33(29)45-34(30)22-23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h7-13,15-22H,1-6H3;1-6,8-9H;/q2*-1; |
| InChIKey | GZVZPFLYQLINLV-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.14 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|