C47H38IrN2-2 — CID 176775809
8-tert-butyl-1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine (PubChem CID 176775809) has the molecular formula C47H38IrN2-2 and a molecular weight of 823.05 g/mol. Its IUPAC name is 8-tert-butyl-1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine.
| Compound Name | 8-tert-butyl-1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 176775809 |
| Molecular Formula | C47H38IrN2-2 |
| Molecular Weight | 823.05 g/mol |
| Exact Mass | 823.27 |
| IUPAC Name | 8-tert-butyl-1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
| SMILES | CC(C)(C)c1ccc2c(ccc3c4ccnc(-c5[c-]cc6c(c5)C(C)(C)c5ccccc5-6)c4ccc23)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C36H30N.C11H8N.Ir/c1-35(2,3)24-12-15-25-22(20-24)10-13-27-26(25)16-17-31-28(27)18-19-37-34(31)23-11-14-30-29-8-6-7-9-32(29)36(4,5)33(30)21-23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h6-10,12-21H,1-5H3;1-6,8-9H;/q2*-1; |
| InChIKey | YZACOAFPUOFOIJ-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.05 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|