C57H50IrN2-2 — CID 176775831
5-(3,5-ditert-butylphenyl)-2-phenylpyridine;1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium (PubChem CID 176775831) has the molecular formula C57H50IrN2-2 and a molecular weight of 955.26 g/mol. Its IUPAC name is 5-(3,5-ditert-butylphenyl)-2-phenylpyridine;1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium.
| Compound Name | 5-(3,5-ditert-butylphenyl)-2-phenylpyridine;1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium |
|---|---|
| PubChem CID | 176775831 |
| Molecular Formula | C57H50IrN2-2 |
| Molecular Weight | 955.26 g/mol |
| Exact Mass | 955.36 |
| IUPAC Name | 5-(3,5-ditert-butylphenyl)-2-phenylpyridine;1-(9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium |
| SMILES | CC(C)(C)c1cc(-c2ccc(-c3[c-]cccc3)nc2)cc(C(C)(C)C)c1.CC1(C)c2ccccc2-c2c[c-]c(-c3nccc4c3ccc3c5ccccc5ccc43)cc21.[Ir] |
| InChI | InChI=1S/C32H22N.C25H28N.Ir/c1-32(2)29-10-6-5-9-26(29)27-14-12-21(19-30(27)32)31-28-16-15-23-22-8-4-3-7-20(22)11-13-24(23)25(28)17-18-33-31;1-24(2,3)21-14-20(15-22(16-21)25(4,5)6)19-12-13-23(26-17-19)18-10-8-7-9-11-18;/h3-11,13-19H,1-2H3;7-10,12-17H,1-6H3;/q2*-1; |
| InChIKey | FXKVUVMWOMKAMU-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.26 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|