C32H27IrNO2 — CID 58986776
1-[3-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]isoquinoline;1-hydroxyethylideneoxidanium;iridium (PubChem CID 58986776) has the molecular formula C32H27IrNO2 and a molecular weight of 649.79 g/mol. Its IUPAC name is 1-[3-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]isoquinoline;1-hydroxyethylideneoxidanium;iridium.
| Compound Name | 1-[3-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]isoquinoline;1-hydroxyethylideneoxidanium;iridium |
|---|---|
| PubChem CID | 58986776 |
| Molecular Formula | C32H27IrNO2 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | 1-[3-(9,9-dimethylfluoren-2-yl)benzene-6-id-1-yl]isoquinoline;1-hydroxyethylideneoxidanium;iridium |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc[c-]c(-c4nccc5ccccc45)c3)cc21.[H]/[O+]=C(\C)O.[Ir] |
| InChI | InChI=1S/C30H22N.C2H4O2.Ir/c1-30(2)27-13-6-5-12-25(27)26-15-14-22(19-28(26)30)21-9-7-10-23(18-21)29-24-11-4-3-8-20(24)16-17-31-29;1-2(3)4;/h3-9,11-19H,1-2H3;1H3,(H,3,4);/q-1;;/p+1 |
| InChIKey | RLMCOFXCDBCAKF-UHFFFAOYSA-O |
| XLogP | 7.74 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|