C22H16IrN- — CID 147779107
iridium;1-[3-(3-methylphenyl)benzene-6-id-1-yl]isoquinoline (PubChem CID 147779107) has the molecular formula C22H16IrN- and a molecular weight of 486.59 g/mol. Its IUPAC name is iridium;1-[3-(3-methylphenyl)benzene-6-id-1-yl]isoquinoline.
| Compound Name | iridium;1-[3-(3-methylphenyl)benzene-6-id-1-yl]isoquinoline |
|---|---|
| PubChem CID | 147779107 |
| Molecular Formula | C22H16IrN- |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | iridium;1-[3-(3-methylphenyl)benzene-6-id-1-yl]isoquinoline |
| SMILES | Cc1cccc(-c2cc[c-]c(-c3nccc4ccccc34)c2)c1.[Ir] |
| InChI | InChI=1S/C22H16N.Ir/c1-16-6-4-8-18(14-16)19-9-5-10-20(15-19)22-21-11-3-2-7-17(21)12-13-23-22;/h2-9,11-15H,1H3;/q-1; |
| InChIKey | AXDBKHSHBHLOMW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|