C72H47IrN4- — CID 140786432
1-[3-[4-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzene-6-id-1-yl]isoquinoline;iridium (PubChem CID 140786432) has the molecular formula C72H47IrN4- and a molecular weight of 1160.41 g/mol. Its IUPAC name is 1-[3-[4-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzene-6-id-1-yl]isoquinoline;iridium.
| Compound Name | 1-[3-[4-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzene-6-id-1-yl]isoquinoline;iridium |
|---|---|
| PubChem CID | 140786432 |
| Molecular Formula | C72H47IrN4- |
| Molecular Weight | 1160.41 g/mol |
| Exact Mass | 1160.34 |
| IUPAC Name | 1-[3-[4-[4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]benzene-6-id-1-yl]isoquinoline;iridium |
| SMILES | [Ir].[c-]1ccc(-c2ccc(-c3nc(-c4cccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)c4)nc(-c4cccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)c4)n3)cc2)cc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C72H47N4.Ir/c1-5-18-49(19-6-1)62-43-63(50-20-7-2-8-21-50)46-66(45-62)57-28-16-31-60(41-57)71-74-70(55-36-34-53(35-37-55)56-27-15-30-59(40-56)69-68-33-14-13-26-54(68)38-39-73-69)75-72(76-71)61-32-17-29-58(42-61)67-47-64(51-22-9-3-10-23-51)44-65(48-67)52-24-11-4-12-25-52;/h1-29,31-48H;/q-1; |
| InChIKey | XOQDLBSXGYCING-UHFFFAOYSA-N |
| XLogP | 18.55 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1160.41 |
| LogP ≤ 5 | 18.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|