C30H24IrN- — CID 164927697
iridium;1-[3-[3-(2-phenylpropan-2-yl)phenyl]benzene-6-id-1-yl]isoquinoline (PubChem CID 164927697) has the molecular formula C30H24IrN- and a molecular weight of 590.75 g/mol. Its IUPAC name is iridium;1-[3-[3-(2-phenylpropan-2-yl)phenyl]benzene-6-id-1-yl]isoquinoline.
| Compound Name | iridium;1-[3-[3-(2-phenylpropan-2-yl)phenyl]benzene-6-id-1-yl]isoquinoline |
|---|---|
| PubChem CID | 164927697 |
| Molecular Formula | C30H24IrN- |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | iridium;1-[3-[3-(2-phenylpropan-2-yl)phenyl]benzene-6-id-1-yl]isoquinoline |
| SMILES | CC(C)(c1ccccc1)c1cccc(-c2cc[c-]c(-c3nccc4ccccc34)c2)c1.[Ir] |
| InChI | InChI=1S/C30H24N.Ir/c1-30(2,26-14-4-3-5-15-26)27-16-9-12-24(21-27)23-11-8-13-25(20-23)29-28-17-7-6-10-22(28)18-19-31-29;/h3-12,14-21H,1-2H3;/q-1; |
| InChIKey | IRDGETHBQFVMMZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|