C45H33IrN2- — CID 158114634
iridium;25-(3-isoquinolin-1-ylbenzene-4-id-1-yl)-4,4,22,22-tetramethyl-15-azaheptacyclo[13.11.1.02,14.03,11.05,10.016,21.023,27]heptacosa-1(27),2(14),3(11),5,7,9,12,16,18,20,23,25-dodecaene (PubChem CID 158114634) has the molecular formula C45H33IrN2- and a molecular weight of 793.99 g/mol. Its IUPAC name is iridium;25-(3-isoquinolin-1-ylbenzene-4-id-1-yl)-4,4,22,22-tetramethyl-15-azaheptacyclo[13.11.1.02,14.03,11.05,10.016,21.023,27]heptacosa-1(27),2(14),3(11),5,7,9,12,16,18,20,23,25-dodecaene.
| Compound Name | iridium;25-(3-isoquinolin-1-ylbenzene-4-id-1-yl)-4,4,22,22-tetramethyl-15-azaheptacyclo[13.11.1.02,14.03,11.05,10.016,21.023,27]heptacosa-1(27),2(14),3(11),5,7,9,12,16,18,20,23,25-dodecaene |
|---|---|
| PubChem CID | 158114634 |
| Molecular Formula | C45H33IrN2- |
| Molecular Weight | 793.99 g/mol |
| Exact Mass | 794.23 |
| IUPAC Name | iridium;25-(3-isoquinolin-1-ylbenzene-4-id-1-yl)-4,4,22,22-tetramethyl-15-azaheptacyclo[13.11.1.02,14.03,11.05,10.016,21.023,27]heptacosa-1(27),2(14),3(11),5,7,9,12,16,18,20,23,25-dodecaene |
| SMILES | CC1(C)c2ccccc2-c2ccc3c(c21)c1cc(-c2cc[c-]c(-c4nccc5ccccc45)c2)cc2c1n3-c1ccccc1C2(C)C.[Ir] |
| InChI | InChI=1S/C45H33N2.Ir/c1-44(2)36-18-9-10-19-38(36)47-39-21-20-33-32-16-7-8-17-35(32)45(3,4)41(33)40(39)34-25-30(26-37(44)43(34)47)28-13-11-14-29(24-28)42-31-15-6-5-12-27(31)22-23-46-42;/h5-13,15-26H,1-4H3;/q-1; |
| InChIKey | LAQXVJFKAWANMT-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.99 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|