C57H41N5 — CID 122427216
1-[3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-5-isoquinolin-1-ylphenyl]isoquinoline (PubChem CID 122427216) has the molecular formula C57H41N5 and a molecular weight of 795.99 g/mol. Its IUPAC name is 1-[3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-5-isoquinolin-1-ylphenyl]isoquinoline.
| Compound Name | 1-[3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-5-isoquinolin-1-ylphenyl]isoquinoline |
|---|---|
| PubChem CID | 122427216 |
| Molecular Formula | C57H41N5 |
| Molecular Weight | 795.99 g/mol |
| Exact Mass | 795.34 |
| IUPAC Name | 1-[3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-5-isoquinolin-1-ylphenyl]isoquinoline |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4cc(-c5nccc6ccccc56)cc(-c5nccc6ccccc56)c4)nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)n3)cc21 |
| InChI | InChI=1S/C57H41N5/c1-56(2)47-19-11-9-17-43(47)45-23-21-36(32-49(45)56)53-60-54(37-22-24-46-44-18-10-12-20-48(44)57(3,4)50(46)33-37)62-55(61-53)40-30-38(51-41-15-7-5-13-34(41)25-27-58-51)29-39(31-40)52-42-16-8-6-14-35(42)26-28-59-52/h5-33H,1-4H3 |
| InChIKey | CFYKRYQEOOGKTF-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.99 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |