C27H25N — CID 121282910
1-(9,9-dimethylfluoren-2-yl)-6-propan-2-ylisoquinoline (PubChem CID 121282910) has the molecular formula C27H25N and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-(9,9-dimethylfluoren-2-yl)-6-propan-2-ylisoquinoline.
| Compound Name | 1-(9,9-dimethylfluoren-2-yl)-6-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 121282910 |
| Molecular Formula | C27H25N |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-(9,9-dimethylfluoren-2-yl)-6-propan-2-ylisoquinoline |
| SMILES | CC(C)c1ccc2c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)nccc2c1 |
| InChI | InChI=1S/C27H25N/c1-17(2)18-9-11-21-19(15-18)13-14-28-26(21)20-10-12-23-22-7-5-6-8-24(22)27(3,4)25(23)16-20/h5-17H,1-4H3 |
| InChIKey | NJGIBCDUOGYIQH-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |