C43H29FIrN2-2 — CID 176775744
1-(7-fluoro-9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine (PubChem CID 176775744) has the molecular formula C43H29FIrN2-2 and a molecular weight of 784.93 g/mol. Its IUPAC name is 1-(7-fluoro-9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine.
| Compound Name | 1-(7-fluoro-9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 176775744 |
| Molecular Formula | C43H29FIrN2-2 |
| Molecular Weight | 784.93 g/mol |
| Exact Mass | 785.20 |
| IUPAC Name | 1-(7-fluoro-9,9-dimethyl-3H-fluoren-3-id-2-yl)naphtho[2,1-f]isoquinoline;iridium;2-phenylpyridine |
| SMILES | CC1(C)c2cc(-c3nccc4c3ccc3c5ccccc5ccc43)[c-]cc2-c2ccc(F)cc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C32H21FN.C11H8N.Ir/c1-32(2)29-17-20(8-11-26(29)27-12-9-21(33)18-30(27)32)31-28-14-13-23-22-6-4-3-5-19(22)7-10-24(23)25(28)15-16-34-31;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-7,9-18H,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | PFIKHHGGBBTKIX-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.93 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|