C40H34IrN2O-2 — CID 140789975
1-(2H-dibenzofuran-2-id-3-yl)-6,6,9,9-tetramethyl-7,8-dihydrobenzo[g]isoquinoline;iridium;2-phenylpyridine (PubChem CID 140789975) has the molecular formula C40H34IrN2O-2 and a molecular weight of 750.94 g/mol. Its IUPAC name is 1-(2H-dibenzofuran-2-id-3-yl)-6,6,9,9-tetramethyl-7,8-dihydrobenzo[g]isoquinoline;iridium;2-phenylpyridine.
| Compound Name | 1-(2H-dibenzofuran-2-id-3-yl)-6,6,9,9-tetramethyl-7,8-dihydrobenzo[g]isoquinoline;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 140789975 |
| Molecular Formula | C40H34IrN2O-2 |
| Molecular Weight | 750.94 g/mol |
| Exact Mass | 751.23 |
| IUPAC Name | 1-(2H-dibenzofuran-2-id-3-yl)-6,6,9,9-tetramethyl-7,8-dihydrobenzo[g]isoquinoline;iridium;2-phenylpyridine |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(-c4[c-]cc5c(c4)oc4ccccc45)nccc3cc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C29H26NO.C11H8N.Ir/c1-28(2)12-13-29(3,4)24-17-22-18(15-23(24)28)11-14-30-27(22)19-9-10-21-20-7-5-6-8-25(20)31-26(21)16-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-8,10-11,14-17H,12-13H2,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | SUBANPRPVBPOEO-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.94 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|