C46H44IrN2O-2 — CID 166051734
5-tert-butyl-2-phenylpyridine;iridium;2-[7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3H-dibenzofuran-3-id-4-yl]pyridine (PubChem CID 166051734) has the molecular formula C46H44IrN2O-2 and a molecular weight of 833.09 g/mol. Its IUPAC name is 5-tert-butyl-2-phenylpyridine;iridium;2-[7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3H-dibenzofuran-3-id-4-yl]pyridine.
| Compound Name | 5-tert-butyl-2-phenylpyridine;iridium;2-[7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3H-dibenzofuran-3-id-4-yl]pyridine |
|---|---|
| PubChem CID | 166051734 |
| Molecular Formula | C46H44IrN2O-2 |
| Molecular Weight | 833.09 g/mol |
| Exact Mass | 833.31 |
| IUPAC Name | 5-tert-butyl-2-phenylpyridine;iridium;2-[7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3H-dibenzofuran-3-id-4-yl]pyridine |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.CC1(C)CCC(C)(C)c2cc(-c3ccc4c(c3)oc3c(-c5ccccn5)[c-]ccc34)ccc21.[Ir] |
| InChI | InChI=1S/C31H28NO.C15H16N.Ir/c1-30(2)15-16-31(3,4)26-18-20(12-14-25(26)30)21-11-13-22-23-8-7-9-24(27-10-5-6-17-32-27)29(23)33-28(22)19-21;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h5-8,10-14,17-19H,15-16H2,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | PGOOBHMHWWITKW-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.09 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|