C31H25IrN3O-2 — CID 172534963
5-tert-butyl-3-(3H-dibenzofuran-3-id-4-yl)pyridazine;iridium;2-phenylpyridine (PubChem CID 172534963) has the molecular formula C31H25IrN3O-2 and a molecular weight of 647.78 g/mol. Its IUPAC name is 5-tert-butyl-3-(3H-dibenzofuran-3-id-4-yl)pyridazine;iridium;2-phenylpyridine.
| Compound Name | 5-tert-butyl-3-(3H-dibenzofuran-3-id-4-yl)pyridazine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 172534963 |
| Molecular Formula | C31H25IrN3O-2 |
| Molecular Weight | 647.78 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | 5-tert-butyl-3-(3H-dibenzofuran-3-id-4-yl)pyridazine;iridium;2-phenylpyridine |
| SMILES | CC(C)(C)c1cnnc(-c2[c-]ccc3c2oc2ccccc23)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C20H17N2O.C11H8N.Ir/c1-20(2,3)13-11-17(22-21-12-13)16-9-6-8-15-14-7-4-5-10-18(14)23-19(15)16;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-8,10-12H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | UFNFATKHMBNFNG-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.78 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|