C36H41IrN2OSi4-2 — CID 162452967
CID 162452967 (PubChem CID 162452967) has the molecular formula C36H41IrN2OSi4-2 and a molecular weight of 822.30 g/mol.
| Compound Name | CID 162452967 |
|---|---|
| PubChem CID | 162452967 |
| Molecular Formula | C36H41IrN2OSi4-2 |
| Molecular Weight | 822.30 g/mol |
| Exact Mass | 822.19 |
| IUPAC Name | — |
| SMILES | C[Si](C)[Si](c1ccc(-c2[c-]ccc3c2oc2ccccc23)nc1)([Si](C)(C)C)[Si](C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C25H33NOSi4.C11H8N.Ir/c1-28(2)31(29(3,4)5,30(6,7)8)19-16-17-23(26-18-19)22-14-11-13-21-20-12-9-10-15-24(20)27-25(21)22;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h9-13,15-18H,1-8H3;1-6,8-9H;/q2*-1; |
| InChIKey | OUZJEAJLDKARSC-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.30 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|