C69H67IrN3O-2 — CID 177102476
CID 177102476 (PubChem CID 177102476) has the molecular formula C69H67IrN3O-2 and a molecular weight of 1146.53 g/mol.
| Compound Name | CID 177102476 |
|---|---|
| PubChem CID | 177102476 |
| Molecular Formula | C69H67IrN3O-2 |
| Molecular Weight | 1146.53 g/mol |
| Exact Mass | 1146.49 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.CC(C)c1cc(-c2ccc3c(c2)C(C)(C)CCCC3(C)C)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C54H51N2O.C15H16N.Ir/c1-32(2)41-28-37(35-23-24-45-46(30-35)54(7,8)26-14-25-53(45,5)6)29-42(33(3)4)50(41)56-48-20-12-11-19-47(48)55-52(56)40-18-13-17-39-44-27-36-22-21-34-15-9-10-16-38(34)43(36)31-49(44)57-51(39)40;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h9-13,15-17,19-24,27-33H,14,25-26H2,1-8H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | HQIOBUMBFSTXRX-UHFFFAOYSA-N |
| XLogP | 19.20 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.53 |
| LogP ≤ 5 | 19.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|