C71H77IrN3OSi2-2 — CID 172542951
CID 172542951 (PubChem CID 172542951) has the molecular formula C71H77IrN3OSi2-2 and a molecular weight of 1236.81 g/mol.
| Compound Name | CID 172542951 |
|---|---|
| PubChem CID | 172542951 |
| Molecular Formula | C71H77IrN3OSi2-2 |
| Molecular Weight | 1236.81 g/mol |
| Exact Mass | 1236.52 |
| IUPAC Name | — |
| SMILES | CC(C)C[Si](CC(C)C)(CC(C)C)c1ccc(-c2cc(C(C)C)c(-n3c(-c4[c-]ccc5c4oc4cc6c(ccc7ccccc76)cc45)nc4ccccc43)c(C(C)C)c2)cc1.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C57H61N2OSi.C14H16NSi.Ir/c1-35(2)32-61(33-36(3)4,34-37(5)6)44-26-24-40(25-27-44)43-29-48(38(7)8)55(49(30-43)39(9)10)59-53-21-14-13-20-52(53)58-57(59)47-19-15-18-46-51-28-42-23-22-41-16-11-12-17-45(41)50(42)31-54(51)60-56(46)47;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h11-18,20-31,35-39H,32-34H2,1-10H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | ZYLISCJHEFDSDJ-UHFFFAOYSA-N |
| XLogP | 19.33 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1236.81 |
| LogP ≤ 5 | 19.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|