About CID 176823422
CID 176823422 (PubChem CID 176823422) has the molecular formula C58H50IrN4OSi-2
and a molecular weight of 1039.37 g/mol.
Molecular Properties
| Compound Name | CID 176823422 |
| PubChem CID | 176823422 |
| Molecular Formula | C58H50IrN4OSi-2 |
| Molecular Weight | 1039.37 g/mol |
| Exact Mass | 1039.34 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)nc23)nc2ccccc21.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C44H34N3O.C14H16NSi.Ir/c1-26(2)34-23-30(28-13-6-5-7-14-28)24-35(27(3)4)42(34)47-39-20-11-10-19-38(39)46-44(47)33-18-12-17-32-41-40(48-43(32)33)25-36-31-16-9-8-15-29(31)21-22-37(36)45-41;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h5-17,19-27H,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | WDLVUCHOTQQUNK-UHFFFAOYSA-N |
| XLogP | 15.10 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1039.37 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176823422 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176823422?
The IUPAC name of CID 176823422 (CID 176823422) is not available.
What is the SMILES notation for CID 176823422?
The canonical SMILES for CID 176823422 is CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)nc23)nc2ccccc21.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir].
What is the InChIKey of CID 176823422?
The InChIKey is WDLVUCHOTQQUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H34N3O.C14H16NSi.Ir/c1-26(2)34-23-30(28-13-6-5-7-14-28)24-35(27(3)4)42(34)47-39-20-11-10-19-38(39)46-44(47)33-18-12-17-32-41-40(48-43(32)33)25-36-31-16-9-8-15-29(31)21-22-37(36)45-41;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h5-17,19-27H,1-4H3;4-7,9-11H,1-3H3;/q2*-1;.
What are the key properties of CID 176823422?
CID 176823422 has a molecular weight of 1039.37 g/mol, XLogP of 15.10, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176823422 is sourced from PubChem (CID 176823422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).