C59H52IrN4OSi-2 — CID 176823802
CID 176823802 (PubChem CID 176823802) has the molecular formula C59H52IrN4OSi-2 and a molecular weight of 1056.41 g/mol.
| Compound Name | CID 176823802 |
|---|---|
| PubChem CID | 176823802 |
| Molecular Formula | C59H52IrN4OSi-2 |
| Molecular Weight | 1056.41 g/mol |
| Exact Mass | 1056.37 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1nc2ccccc2c2c1ccc1c3cc[c-]c(-c4nc5ccccc5n4-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)c3oc12.[Ir] |
| InChI | InChI=1S/C45H36N3O.C14H16NSi.Ir/c1-26(2)36-24-30(29-14-7-6-8-15-29)25-37(27(3)4)42(36)48-40-21-12-11-20-39(40)47-45(48)35-18-13-17-32-33-23-22-31-28(5)46-38-19-10-9-16-34(38)41(31)44(33)49-43(32)35;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h6-17,19-27H,1-5H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;; |
| InChIKey | BSCMYCKKOMKKQV-YLSPSJLGSA-N |
| XLogP | 15.41 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1056.41 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|