C56H49IrN3O2Si-2 — CID 176723910
CID 176723910 (PubChem CID 176723910) has the molecular formula C56H49IrN3O2Si-2 and a molecular weight of 1019.35 g/mol.
| Compound Name | CID 176723910 |
|---|---|
| PubChem CID | 176723910 |
| Molecular Formula | C56H49IrN3O2Si-2 |
| Molecular Weight | 1019.35 g/mol |
| Exact Mass | 1019.34 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc([Si](C)(C)C)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2c3ccc3c2ccc2c4ccccc4oc23)nc2ccccc21.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C44H39N2O2Si.C12H10N.Ir/c1-25(2)35-23-27(49(5,6)7)24-36(26(3)4)40(35)46-38-17-10-9-16-37(38)45-44(46)34-15-12-14-29-31-21-22-32-33(42(31)48-43(29)34)20-19-30-28-13-8-11-18-39(28)47-41(30)32;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h8-14,16-26H,1-7H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | RNRYMJQZFAHPIX-ICMJTWPQSA-N |
| XLogP | 15.09 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.35 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|