C45H37IrN5O-2 — CID 164825763
2-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]cinnoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 164825763) has the molecular formula C45H37IrN5O-2 and a molecular weight of 859.06 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]cinnoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]cinnoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 164825763 |
| Molecular Formula | C45H37IrN5O-2 |
| Molecular Weight | 859.06 g/mol |
| Exact Mass | 859.28 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]cinnoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2ccccc23)nc2c3ccccc3nnc21.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C33H27N4O.C12H10N.Ir/c1-19(2)21-13-9-14-22(20(3)4)30(21)37-32(34-29-25-12-5-7-17-27(25)35-36-33(29)37)26-16-10-15-24-23-11-6-8-18-28(23)38-31(24)26;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-15,17-20H,1-4H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | BTUDHIBAPLQMMO-ICMJTWPQSA-N |
| XLogP | 11.44 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.06 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|