C52H47IrN3O-2 — CID 170941208
iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-(7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)benzimidazole;2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 170941208) has the molecular formula C52H47IrN3O-2 and a molecular weight of 925.20 g/mol. Its IUPAC name is iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-(7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)benzimidazole;2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-(7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)benzimidazole;2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 170941208 |
| Molecular Formula | C52H47IrN3O-2 |
| Molecular Weight | 925.20 g/mol |
| Exact Mass | 925.35 |
| IUPAC Name | iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-(7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)benzimidazole;2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | CC(C)c1ccc2c(c1)oc1c(-c3nc4ccccc4n3-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)[c-]ccc12.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C40H37N2O.C12H10N.Ir/c1-24(2)28-19-20-30-31-15-12-16-32(39(31)43-37(30)23-28)40-41-35-17-10-11-18-36(35)42(40)38-33(25(3)4)21-29(22-34(38)26(5)6)27-13-8-7-9-14-27;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h7-15,17-26H,1-6H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | QMKCTKWUAFVWAK-ICMJTWPQSA-N |
| XLogP | 14.28 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.20 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|