C46H38IrN4O-2 — CID 164825166
2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]quinoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 164825166) has the molecular formula C46H38IrN4O-2 and a molecular weight of 858.07 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]quinoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]quinoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 164825166 |
| Molecular Formula | C46H38IrN4O-2 |
| Molecular Weight | 858.07 g/mol |
| Exact Mass | 858.29 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]imidazo[4,5-c]quinoline;iridium;2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2ccccc23)nc2cnc3ccccc3c21.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C34H28N3O.C12H10N.Ir/c1-20(2)22-13-9-14-23(21(3)4)31(22)37-32-26-12-5-7-17-28(26)35-19-29(32)36-34(37)27-16-10-15-25-24-11-6-8-18-30(24)38-33(25)27;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-15,17-21H,1-4H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | CIAAGZDFFZRYJB-ICMJTWPQSA-N |
| XLogP | 12.04 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.07 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|