About CID 176817408
CID 176817408 (PubChem CID 176817408) has the molecular formula C61H47IrN3O-2
and a molecular weight of 1033.30 g/mol.
Molecular Properties
| Compound Name | CID 176817408 |
| PubChem CID | 176817408 |
| Molecular Formula | C61H47IrN3O-2 |
| Molecular Weight | 1033.30 g/mol |
| Exact Mass | 1033.35 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)nc2ccc3ccccc3c21.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C49H37N2O.C12H10N.Ir/c1-29(2)40-26-35(31-13-6-5-7-14-31)27-41(30(3)4)46(40)51-47-37-18-11-9-16-33(37)23-24-44(47)50-49(51)39-20-12-19-38-43-25-34-22-21-32-15-8-10-17-36(32)42(34)28-45(43)52-48(38)39;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-19,21-30H,1-4H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | GHZNXMZOLDBEKW-ICMJTWPQSA-N |
| XLogP | 16.62 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1033.30 |
| LogP ≤ 5 | 16.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176817408 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176817408?
The IUPAC name of CID 176817408 (CID 176817408) is not available.
What is the SMILES notation for CID 176817408?
The canonical SMILES for CID 176817408 is CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)nc2ccc3ccccc3c21.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir].
What is the InChIKey of CID 176817408?
The InChIKey is GHZNXMZOLDBEKW-ICMJTWPQSA-N. The full InChI is InChI=1S/C49H37N2O.C12H10N.Ir/c1-29(2)40-26-35(31-13-6-5-7-14-31)27-41(30(3)4)46(40)51-47-37-18-11-9-16-33(37)23-24-44(47)50-49(51)39-20-12-19-38-43-25-34-22-21-32-15-8-10-17-36(32)42(34)28-45(43)52-48(38)39;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-19,21-30H,1-4H3;2-5,7-9H,1H3;/q2*-1;/i;1D3;.
What are the key properties of CID 176817408?
CID 176817408 has a molecular weight of 1033.30 g/mol, XLogP of 16.62, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176817408 is sourced from PubChem (CID 176817408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).