About CID 176624392
CID 176624392 (PubChem CID 176624392) has the molecular formula C61H53IrN3O-2
and a molecular weight of 1039.35 g/mol.
Molecular Properties
| Compound Name | CID 176624392 |
| PubChem CID | 176624392 |
| Molecular Formula | C61H53IrN3O-2 |
| Molecular Weight | 1039.35 g/mol |
| Exact Mass | 1039.40 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1ccc2nc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)n(-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)c2c1.[Ir] |
| InChI | InChI=1S/C46H37N2O.C15H16N.Ir/c1-27(2)37-24-33(30-12-7-6-8-13-30)25-38(28(3)4)44(37)48-42-22-29(5)18-21-41(42)47-46(48)36-17-11-16-35-40-23-32-20-19-31-14-9-10-15-34(31)39(32)26-43(40)49-45(35)36;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h6-16,18-28H,1-5H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;; |
| InChIKey | DBRLZTGHDVIWAJ-YLSPSJLGSA-N |
| XLogP | 16.76 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1039.35 |
| LogP ≤ 5 | 16.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176624392 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176624392?
The IUPAC name of CID 176624392 (CID 176624392) is not available.
What is the SMILES notation for CID 176624392?
The canonical SMILES for CID 176624392 is CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1ccc2nc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)n(-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)c2c1.[Ir].
What is the InChIKey of CID 176624392?
The InChIKey is DBRLZTGHDVIWAJ-YLSPSJLGSA-N. The full InChI is InChI=1S/C46H37N2O.C15H16N.Ir/c1-27(2)37-24-33(30-12-7-6-8-13-30)25-38(28(3)4)44(37)48-42-22-29(5)18-21-41(42)47-46(48)36-17-11-16-35-40-23-32-20-19-31-14-9-10-15-34(31)39(32)26-43(40)49-45(35)36;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h6-16,18-28H,1-5H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;;.
What are the key properties of CID 176624392?
CID 176624392 has a molecular weight of 1039.35 g/mol, XLogP of 16.76, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176624392 is sourced from PubChem (CID 176624392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).