C59H53IrN3O-2 — CID 176583831
4-tert-butyl-2-phenylpyridine;iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-phenyl-6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole (PubChem CID 176583831) has the molecular formula C59H53IrN3O-2 and a molecular weight of 1015.33 g/mol. Its IUPAC name is 4-tert-butyl-2-phenylpyridine;iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-phenyl-6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole.
| Compound Name | 4-tert-butyl-2-phenylpyridine;iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-phenyl-6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole |
|---|---|
| PubChem CID | 176583831 |
| Molecular Formula | C59H53IrN3O-2 |
| Molecular Weight | 1015.33 g/mol |
| Exact Mass | 1015.40 |
| IUPAC Name | 4-tert-butyl-2-phenylpyridine;iridium;1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[7-phenyl-6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1c(-c2ccccc2)ccc2c1oc1c(-c3nc4ccccc4n3-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C44H37N2O.C15H16N.Ir/c1-27(2)37-25-32(30-15-8-6-9-16-30)26-38(28(3)4)41(37)46-40-22-13-12-21-39(40)45-44(46)36-20-14-19-34-35-24-23-33(31-17-10-7-11-18-31)29(5)42(35)47-43(34)36;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h6-19,21-28H,1-5H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;; |
| InChIKey | DQEGHSUKKYYYNW-YLSPSJLGSA-N |
| XLogP | 16.13 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.33 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|