C59H48IrN4OS-2 — CID 176617804
CID 176617804 (PubChem CID 176617804) has the molecular formula C59H48IrN4OS-2 and a molecular weight of 1053.34 g/mol.
| Compound Name | CID 176617804 |
|---|---|
| PubChem CID | 176617804 |
| Molecular Formula | C59H48IrN4OS-2 |
| Molecular Weight | 1053.34 g/mol |
| Exact Mass | 1053.32 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(cc23)sc2cc(C#N)ccc24)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C44H32N3OS.C15H16N.Ir/c1-25(2)33-20-29(28-11-6-5-7-12-28)21-34(26(3)4)42(33)47-38-16-9-8-15-37(38)46-44(47)32-14-10-13-31-35-23-41-36(22-39(35)48-43(31)32)30-18-17-27(24-45)19-40(30)49-41;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h5-13,15-23,25-26H,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | FUWFDBDUGDURRU-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.34 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|