C55H42IrN4O-2 — CID 167388005
iridium;6-[1-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine (PubChem CID 167388005) has the molecular formula C55H42IrN4O-2 and a molecular weight of 967.19 g/mol. Its IUPAC name is iridium;6-[1-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine.
| Compound Name | iridium;6-[1-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine |
|---|---|
| PubChem CID | 167388005 |
| Molecular Formula | C55H42IrN4O-2 |
| Molecular Weight | 967.19 g/mol |
| Exact Mass | 967.30 |
| IUPAC Name | iridium;6-[1-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine |
| SMILES | CC(C)c1cc(-c2ccc(-c3ccccc3)cc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc(C#N)ccc23)nc2ccccc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C44H34N3O.C11H8N.Ir/c1-27(2)37-24-33(32-20-18-31(19-21-32)30-11-6-5-7-12-30)25-38(28(3)4)42(37)47-40-16-9-8-15-39(40)46-44(47)36-14-10-13-35-34-22-17-29(26-45)23-41(34)48-43(35)36;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-13,15-25,27-28H,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | SSFYBATVIKILGV-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.19 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|