C67H63IrN3O-2 — CID 177264559
CID 177264559 (PubChem CID 177264559) has the molecular formula C67H63IrN3O-2 and a molecular weight of 1118.48 g/mol.
| Compound Name | CID 177264559 |
|---|---|
| PubChem CID | 177264559 |
| Molecular Formula | C67H63IrN3O-2 |
| Molecular Weight | 1118.48 g/mol |
| Exact Mass | 1118.46 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(cc5c6c(cccc64)C(C)(C)CC5(C)C)cc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C52H47N2O.C15H16N.Ir/c1-30(2)38-24-33(32-16-10-9-11-17-32)25-39(31(3)4)48(38)54-45-23-13-12-22-44(45)53-50(54)37-20-14-19-36-41-26-34-27-43-47-35(40(34)28-46(41)55-49(36)37)18-15-21-42(47)51(5,6)29-52(43,7)8;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h9-19,21-28,30-31H,29H2,1-8H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | WLQZTUGSVCKDIQ-UHFFFAOYSA-N |
| XLogP | 18.41 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.48 |
| LogP ≤ 5 | 18.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|