About CID 176823065
CID 176823065 (PubChem CID 176823065) has the molecular formula C58H50IrN4O2-2
and a molecular weight of 1030.30 g/mol.
Molecular Properties
| Compound Name | CID 176823065 |
| PubChem CID | 176823065 |
| Molecular Formula | C58H50IrN4O2-2 |
| Molecular Weight | 1030.30 g/mol |
| Exact Mass | 1030.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1cccc2oc3cc4c(nc3c12)oc1c(-c2nc3ccccc3n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)[c-]ccc14.[Ir] |
| InChI | InChI=1S/C43H34N3O2.C15H16N.Ir/c1-24(2)31-21-28(27-14-7-6-8-15-27)22-32(25(3)4)40(31)46-35-19-10-9-18-34(35)44-42(46)30-17-12-16-29-33-23-37-39(45-43(33)48-41(29)30)38-26(5)13-11-20-36(38)47-37;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h6-16,18-25H,1-5H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;; |
| InChIKey | CXFZJAGRRLBGQJ-YLSPSJLGSA-N |
| XLogP | 15.75 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1030.30 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 176823065 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176823065?
The IUPAC name of CID 176823065 (CID 176823065) is not available.
What is the SMILES notation for CID 176823065?
The canonical SMILES for CID 176823065 is CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1cccc2oc3cc4c(nc3c12)oc1c(-c2nc3ccccc3n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)[c-]ccc14.[Ir].
What is the InChIKey of CID 176823065?
The InChIKey is CXFZJAGRRLBGQJ-YLSPSJLGSA-N. The full InChI is InChI=1S/C43H34N3O2.C15H16N.Ir/c1-24(2)31-21-28(27-14-7-6-8-15-27)22-32(25(3)4)40(31)46-35-19-10-9-18-34(35)44-42(46)30-17-12-16-29-33-23-37-39(45-43(33)48-41(29)30)38-26(5)13-11-20-36(38)47-37;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h6-16,18-25H,1-5H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;;.
What are the key properties of CID 176823065?
CID 176823065 has a molecular weight of 1030.30 g/mol, XLogP of 15.75, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176823065 is sourced from PubChem (CID 176823065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).