C59H50IrN4O-2 — CID 176823381
CID 176823381 (PubChem CID 176823381) has the molecular formula C59H50IrN4O-2 and a molecular weight of 1023.29 g/mol.
| Compound Name | CID 176823381 |
|---|---|
| PubChem CID | 176823381 |
| Molecular Formula | C59H50IrN4O-2 |
| Molecular Weight | 1023.29 g/mol |
| Exact Mass | 1023.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2nc4c(ccc5ccccc54)cc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C44H34N3O.C15H16N.Ir/c1-26(2)35-24-31(28-13-6-5-7-14-28)25-36(27(3)4)41(35)47-39-20-11-10-19-38(39)45-43(47)34-18-12-17-33-37-23-30-22-21-29-15-8-9-16-32(29)40(30)46-44(37)48-42(33)34;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h5-17,19-27H,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | QITHUNKFUMZING-UHFFFAOYSA-N |
| XLogP | 15.85 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.29 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|