C60H49F2IrN3O-2 — CID 171461698
CID 171461698 (PubChem CID 171461698) has the molecular formula C60H49F2IrN3O-2 and a molecular weight of 1058.28 g/mol.
| Compound Name | CID 171461698 |
|---|---|
| PubChem CID | 171461698 |
| Molecular Formula | C60H49F2IrN3O-2 |
| Molecular Weight | 1058.28 g/mol |
| Exact Mass | 1058.35 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cc(F)cc2)nc1.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)c(F)c23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C45H34FN2O.C15H15FN.Ir/c1-26(2)35-23-30(28-13-6-5-7-14-28)24-36(27(3)4)43(35)48-39-20-11-10-19-38(39)47-45(48)34-18-12-17-33-41-40(49-44(33)34)25-37-31-16-9-8-15-29(31)21-22-32(37)42(41)46;1-15(2,3)12-6-9-14(17-10-12)11-4-7-13(16)8-5-11;/h5-17,19-27H,1-4H3;4,6-10H,1-3H3;/q2*-1; |
| InChIKey | LNBJSVFMNOJZAQ-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.28 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|