C75H72FIrN3O-2 — CID 171461647
CID 171461647 (PubChem CID 171461647) has the molecular formula C75H72FIrN3O-2 and a molecular weight of 1242.64 g/mol.
| Compound Name | CID 171461647 |
|---|---|
| PubChem CID | 171461647 |
| Molecular Formula | C75H72FIrN3O-2 |
| Molecular Weight | 1242.64 g/mol |
| Exact Mass | 1242.53 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cc(F)cc2)nc1.CC(C)c1cc(C(C)C)c(-c2ccc(-c3cc(C(C)C)c(-n4c(-c5[c-]ccc6c5oc5cc7c(ccc8ccccc87)cc56)nc5ccccc54)c(C(C)C)c3)cc2)c(C(C)C)c1.[Ir] |
| InChI | InChI=1S/C60H57N2O.C15H15FN.Ir/c1-34(2)43-29-48(35(3)4)57(49(30-43)36(5)6)41-25-22-39(23-26-41)44-31-50(37(7)8)58(51(32-44)38(9)10)62-55-21-14-13-20-54(55)61-60(62)47-19-15-18-46-53-28-42-27-24-40-16-11-12-17-45(40)52(42)33-56(53)63-59(46)47;1-15(2,3)12-6-9-14(17-10-12)11-4-7-13(16)8-5-11;/h11-18,20-38H,1-10H3;4,6-10H,1-3H3;/q2*-1; |
| InChIKey | RTLDQOWQMFIYEB-UHFFFAOYSA-N |
| XLogP | 21.63 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1242.64 |
| LogP ≤ 5 | 21.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|